C15H15F19OSi — CID 59112318
methoxy-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-bis(3,3,3-trifluoropropyl)silane (PubChem CID 59112318) has the molecular formula C15H15F19OSi and a molecular weight of 600.33 g/mol. Its IUPAC name is methoxy-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-bis(3,3,3-trifluoropropyl)silane.
| Compound Name | methoxy-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-bis(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 59112318 |
| Molecular Formula | C15H15F19OSi |
| Molecular Weight | 600.33 g/mol |
| Exact Mass | 600.06 |
| IUPAC Name | methoxy-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-bis(3,3,3-trifluoropropyl)silane |
| SMILES | CO[Si](CCC(F)(F)F)(CCC(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H15F19OSi/c1-35-36(6-3-9(18,19)20,7-4-10(21,22)23)5-2-8(16,17)11(24,25)12(26,27)13(28,29)14(30,31)15(32,33)34/h2-7H2,1H3 |
| InChIKey | FLRYLKOQCSSHED-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.33 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|