C10H15F9OSi — CID 59112321
ethoxy-dimethyl-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane (PubChem CID 59112321) has the molecular formula C10H15F9OSi and a molecular weight of 350.30 g/mol. Its IUPAC name is ethoxy-dimethyl-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane.
| Compound Name | ethoxy-dimethyl-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane |
|---|---|
| PubChem CID | 59112321 |
| Molecular Formula | C10H15F9OSi |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | ethoxy-dimethyl-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane |
| SMILES | CCO[Si](C)(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H15F9OSi/c1-4-20-21(2,3)6-5-7(11,12)8(13,14)9(15,16)10(17,18)19/h4-6H2,1-3H3 |
| InChIKey | BVDSCXWHELDBQR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|