C13H15F15OSi — CID 59112326
methoxy-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-bis(3,3,3-trifluoropropyl)silane (PubChem CID 59112326) has the molecular formula C13H15F15OSi and a molecular weight of 500.32 g/mol. Its IUPAC name is methoxy-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-bis(3,3,3-trifluoropropyl)silane.
| Compound Name | methoxy-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-bis(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 59112326 |
| Molecular Formula | C13H15F15OSi |
| Molecular Weight | 500.32 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | methoxy-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-bis(3,3,3-trifluoropropyl)silane |
| SMILES | CO[Si](CCC(F)(F)F)(CCC(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H15F15OSi/c1-29-30(6-3-9(16,17)18,7-4-10(19,20)21)5-2-8(14,15)11(22,23)12(24,25)13(26,27)28/h2-7H2,1H3 |
| InChIKey | OTFMVKGARZMBJF-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.32 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|