C9H13F9OSi — CID 59112327
methoxy-dimethyl-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane (PubChem CID 59112327) has the molecular formula C9H13F9OSi and a molecular weight of 336.27 g/mol. Its IUPAC name is methoxy-dimethyl-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane.
| Compound Name | methoxy-dimethyl-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane |
|---|---|
| PubChem CID | 59112327 |
| Molecular Formula | C9H13F9OSi |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | methoxy-dimethyl-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane |
| SMILES | CO[Si](C)(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H13F9OSi/c1-19-20(2,3)5-4-6(10,11)7(12,13)8(14,15)9(16,17)18/h4-5H2,1-3H3 |
| InChIKey | OJSFFLCTIKRXOA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|