C12H15F13OSi — CID 59112329
3,3,4,4,5,5,5-heptafluoropentyl-methoxy-bis(3,3,3-trifluoropropyl)silane (PubChem CID 59112329) has the molecular formula C12H15F13OSi and a molecular weight of 450.31 g/mol. Its IUPAC name is 3,3,4,4,5,5,5-heptafluoropentyl-methoxy-bis(3,3,3-trifluoropropyl)silane.
| Compound Name | 3,3,4,4,5,5,5-heptafluoropentyl-methoxy-bis(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 59112329 |
| Molecular Formula | C12H15F13OSi |
| Molecular Weight | 450.31 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 3,3,4,4,5,5,5-heptafluoropentyl-methoxy-bis(3,3,3-trifluoropropyl)silane |
| SMILES | CO[Si](CCC(F)(F)F)(CCC(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H15F13OSi/c1-26-27(6-3-9(15,16)17,7-4-10(18,19)20)5-2-8(13,14)11(21,22)12(23,24)25/h2-7H2,1H3 |
| InChIKey | HGBSFYSWOXVUQC-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.31 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|