C12H26O10P2 — CID 59112421
6-(hydroxymethoxy)-4-phosphono-2-(2-phosphonobutyl)heptanoic acid (PubChem CID 59112421) has the molecular formula C12H26O10P2 and a molecular weight of 392.28 g/mol. Its IUPAC name is 6-(hydroxymethoxy)-4-phosphono-2-(2-phosphonobutyl)heptanoic acid.
| Compound Name | 6-(hydroxymethoxy)-4-phosphono-2-(2-phosphonobutyl)heptanoic acid |
|---|---|
| PubChem CID | 59112421 |
| Molecular Formula | C12H26O10P2 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 6-(hydroxymethoxy)-4-phosphono-2-(2-phosphonobutyl)heptanoic acid |
| SMILES | CCC(CC(CC(CC(C)OCO)P(=O)(O)O)C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C12H26O10P2/c1-3-10(23(16,17)18)5-9(12(14)15)6-11(24(19,20)21)4-8(2)22-7-13/h8-11,13H,3-7H2,1-2H3,(H,14,15)(H2,16,17,18)(H2,19,20,21) |
| InChIKey | WNQNFUGKVLYZRK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|