C27H31N2O7S2- — CID 59112593
4-[(2Z)-5-methyl-2-[[6-methyl-1-(4-sulfonatobutyl)quinolin-1-ium-2-yl]methylidene]-1,3-benzoxazol-3-yl]butane-1-sulfonate (PubChem CID 59112593) has the molecular formula C27H31N2O7S2- and a molecular weight of 559.69 g/mol. Its IUPAC name is 4-[(2Z)-5-methyl-2-[[6-methyl-1-(4-sulfonatobutyl)quinolin-1-ium-2-yl]methylidene]-1,3-benzoxazol-3-yl]butane-1-sulfonate.
| Compound Name | 4-[(2Z)-5-methyl-2-[[6-methyl-1-(4-sulfonatobutyl)quinolin-1-ium-2-yl]methylidene]-1,3-benzoxazol-3-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 59112593 |
| Molecular Formula | C27H31N2O7S2- |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 4-[(2Z)-5-methyl-2-[[6-methyl-1-(4-sulfonatobutyl)quinolin-1-ium-2-yl]methylidene]-1,3-benzoxazol-3-yl]butane-1-sulfonate |
| SMILES | Cc1ccc2c(c1)N(CCCCS(=O)(=O)[O-])/C(=C/c1ccc3cc(C)ccc3[n+]1CCCCS(=O)(=O)[O-])O2 |
| InChI | InChI=1S/C27H32N2O7S2/c1-20-7-11-24-22(17-20)9-10-23(28(24)13-3-5-15-37(30,31)32)19-27-29(14-4-6-16-38(33,34)35)25-18-21(2)8-12-26(25)36-27/h7-12,17-19H,3-6,13-16H2,1-2H3,(H-,30,31,32,33,34,35)/p-1 |
| InChIKey | SDVGICPSWBWNBS-UHFFFAOYSA-M |
| XLogP | 3.59 |
| TPSA | 130.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|