C21H34O4Si — CID 59112833
[3-[4,4-dimethyl-5-(2-methylbutan-2-yl)-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl]phenoxy]-ethyl-dimethylsilane (PubChem CID 59112833) has the molecular formula C21H34O4Si and a molecular weight of 378.59 g/mol. Its IUPAC name is [3-[4,4-dimethyl-5-(2-methylbutan-2-yl)-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl]phenoxy]-ethyl-dimethylsilane.
| Compound Name | [3-[4,4-dimethyl-5-(2-methylbutan-2-yl)-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl]phenoxy]-ethyl-dimethylsilane |
|---|---|
| PubChem CID | 59112833 |
| Molecular Formula | C21H34O4Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | [3-[4,4-dimethyl-5-(2-methylbutan-2-yl)-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl]phenoxy]-ethyl-dimethylsilane |
| SMILES | CCC(C)(C)C12OOC1(c1cccc(O[Si](C)(C)CC)c1)OCC2(C)C |
| InChI | InChI=1S/C21H34O4Si/c1-9-18(3,4)21-19(5,6)15-22-20(21,24-25-21)16-12-11-13-17(14-16)23-26(7,8)10-2/h11-14H,9-10,15H2,1-8H3 |
| InChIKey | BHXNOCQBECBBLC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|