C19H26ClN3S — CID 59113183
4-[[(4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidin-2-ylidene]amino]-3-chloro-5-methylbenzonitrile (PubChem CID 59113183) has the molecular formula C19H26ClN3S and a molecular weight of 363.96 g/mol. Its IUPAC name is 4-[[(4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidin-2-ylidene]amino]-3-chloro-5-methylbenzonitrile.
| Compound Name | 4-[[(4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidin-2-ylidene]amino]-3-chloro-5-methylbenzonitrile |
|---|---|
| PubChem CID | 59113183 |
| Molecular Formula | C19H26ClN3S |
| Molecular Weight | 363.96 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 4-[[(4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidin-2-ylidene]amino]-3-chloro-5-methylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(Cl)c1/N=C1\SC[C@H](CC(C)C)N1CC(C)C |
| InChI | InChI=1S/C19H26ClN3S/c1-12(2)6-16-11-24-19(23(16)10-13(3)4)22-18-14(5)7-15(9-21)8-17(18)20/h7-8,12-13,16H,6,10-11H2,1-5H3/b22-19-/t16-/m0/s1 |
| InChIKey | IGFASKZMYSXQAY-VFOOBRQFSA-N |
| XLogP | 5.63 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.96 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|