C24H28FN5O2 — CID 59113207
(3Z)-1-[[5-ethyl-1-(3-methylbutyl)benzimidazol-2-yl]methyl]-3-(2-fluoroethoxyimino)pyrrolo[2,3-b]pyridin-2-one (PubChem CID 59113207) has the molecular formula C24H28FN5O2 and a molecular weight of 437.52 g/mol. Its IUPAC name is (3Z)-1-[[5-ethyl-1-(3-methylbutyl)benzimidazol-2-yl]methyl]-3-(2-fluoroethoxyimino)pyrrolo[2,3-b]pyridin-2-one.
| Compound Name | (3Z)-1-[[5-ethyl-1-(3-methylbutyl)benzimidazol-2-yl]methyl]-3-(2-fluoroethoxyimino)pyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 59113207 |
| Molecular Formula | C24H28FN5O2 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (3Z)-1-[[5-ethyl-1-(3-methylbutyl)benzimidazol-2-yl]methyl]-3-(2-fluoroethoxyimino)pyrrolo[2,3-b]pyridin-2-one |
| SMILES | CCc1ccc2c(c1)nc(CN1C(=O)/C(=N\OCCF)c3cccnc31)n2CCC(C)C |
| InChI | InChI=1S/C24H28FN5O2/c1-4-17-7-8-20-19(14-17)27-21(29(20)12-9-16(2)3)15-30-23-18(6-5-11-26-23)22(24(30)31)28-32-13-10-25/h5-8,11,14,16H,4,9-10,12-13,15H2,1-3H3/b28-22- |
| InChIKey | XHXRUGGQAIENLA-SLMZUGIISA-N |
| XLogP | 4.28 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|