C25H28NO2+ — CID 59113549
[(4R,5S)-9,9-dimethyl-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 9-methylfluorene-9-carboxylate (PubChem CID 59113549) has the molecular formula C25H28NO2+ and a molecular weight of 374.50 g/mol. Its IUPAC name is [(4R,5S)-9,9-dimethyl-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 9-methylfluorene-9-carboxylate.
| Compound Name | [(4R,5S)-9,9-dimethyl-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 9-methylfluorene-9-carboxylate |
|---|---|
| PubChem CID | 59113549 |
| Molecular Formula | C25H28NO2+ |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | [(4R,5S)-9,9-dimethyl-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 9-methylfluorene-9-carboxylate |
| SMILES | CC1(C(=O)OC2CC3C4C[C@H]4[C@H](C2)[N+]3(C)C)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H28NO2/c1-25(20-10-6-4-8-16(20)17-9-5-7-11-21(17)25)24(27)28-15-12-22-18-14-19(18)23(13-15)26(22,2)3/h4-11,15,18-19,22-23H,12-14H2,1-3H3/q+1/t15?,18-,19?,22+,23?/m1/s1 |
| InChIKey | LJGLQNLVVYJBIJ-XAZRICRQSA-N |
| XLogP | 4.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|