C15H19NO — CID 59113730
2,2,4,4,6-pentamethyl-3H-chromene-8-carbonitrile (PubChem CID 59113730) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 2,2,4,4,6-pentamethyl-3H-chromene-8-carbonitrile.
| Compound Name | 2,2,4,4,6-pentamethyl-3H-chromene-8-carbonitrile |
|---|---|
| PubChem CID | 59113730 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 2,2,4,4,6-pentamethyl-3H-chromene-8-carbonitrile |
| SMILES | Cc1cc(C#N)c2c(c1)C(C)(C)CC(C)(C)O2 |
| InChI | InChI=1S/C15H19NO/c1-10-6-11(8-16)13-12(7-10)14(2,3)9-15(4,5)17-13/h6-7H,9H2,1-5H3 |
| InChIKey | PPWMRVMCZYFLMF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |