About CID 59113753
CID 59113753 (PubChem CID 59113753) has the molecular formula C22H43N4O3
and a molecular weight of 411.61 g/mol.
Molecular Properties
| Compound Name | CID 59113753 |
| PubChem CID | 59113753 |
| Molecular Formula | C22H43N4O3 |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.33 |
| IUPAC Name | — |
| SMILES | CN(CC(=O)N(C)C1CC(C)(C)N([O])C(C)(C)C1)C1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C22H43N4O3/c1-19(2)11-16(12-20(3,4)25(19)28)23(9)15-18(27)24(10)17-13-21(5,6)26(29)22(7,8)14-17/h16-17,28H,11-15H2,1-10H3 |
| InChIKey | OXJWBLABXSDWGN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 59113753 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59113753?
The IUPAC name of CID 59113753 (CID 59113753) is not available.
What is the SMILES notation for CID 59113753?
The canonical SMILES for CID 59113753 is CN(CC(=O)N(C)C1CC(C)(C)N([O])C(C)(C)C1)C1CC(C)(C)N(O)C(C)(C)C1.
What is the InChIKey of CID 59113753?
The InChIKey is OXJWBLABXSDWGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H43N4O3/c1-19(2)11-16(12-20(3,4)25(19)28)23(9)15-18(27)24(10)17-13-21(5,6)26(29)22(7,8)14-17/h16-17,28H,11-15H2,1-10H3.
What are the key properties of CID 59113753?
CID 59113753 has a molecular weight of 411.61 g/mol, XLogP of 3.15, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59113753 is sourced from PubChem (CID 59113753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).