C9H18N2O2 — CID 59113758
4-hydroxy-1,3,3,5,5-pentamethylpiperazin-2-one (PubChem CID 59113758) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 4-hydroxy-1,3,3,5,5-pentamethylpiperazin-2-one.
| Compound Name | 4-hydroxy-1,3,3,5,5-pentamethylpiperazin-2-one |
|---|---|
| PubChem CID | 59113758 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 4-hydroxy-1,3,3,5,5-pentamethylpiperazin-2-one |
| SMILES | CN1CC(C)(C)N(O)C(C)(C)C1=O |
| InChI | InChI=1S/C9H18N2O2/c1-8(2)6-10(5)7(12)9(3,4)11(8)13/h13H,6H2,1-5H3 |
| InChIKey | PFJVUDPDVYEPBY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |