About CID 59113763
CID 59113763 (PubChem CID 59113763) has the molecular formula C21H39N4O4
and a molecular weight of 411.57 g/mol.
Molecular Properties
| Compound Name | CID 59113763 |
| PubChem CID | 59113763 |
| Molecular Formula | C21H39N4O4 |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.30 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(N(C=O)CN(C=O)C2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C21H39N4O4/c1-18(2)9-16(10-19(3,4)24(18)28)22(14-26)13-23(15-27)17-11-20(5,6)25(29)21(7,8)12-17/h14-17,28H,9-13H2,1-8H3 |
| InChIKey | UWQXYOINZZSCKE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 59113763 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59113763?
The IUPAC name of CID 59113763 (CID 59113763) is not available.
What is the SMILES notation for CID 59113763?
The canonical SMILES for CID 59113763 is CC1(C)CC(N(C=O)CN(C=O)C2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1[O].
What is the InChIKey of CID 59113763?
The InChIKey is UWQXYOINZZSCKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H39N4O4/c1-18(2)9-16(10-19(3,4)24(18)28)22(14-26)13-23(15-27)17-11-20(5,6)25(29)21(7,8)12-17/h14-17,28H,9-13H2,1-8H3.
What are the key properties of CID 59113763?
CID 59113763 has a molecular weight of 411.57 g/mol, XLogP of 2.64, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59113763 is sourced from PubChem (CID 59113763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).