About CID 59113766
CID 59113766 (PubChem CID 59113766) has the molecular formula C21H41N4O3
and a molecular weight of 397.58 g/mol.
Molecular Properties
| Compound Name | CID 59113766 |
| PubChem CID | 59113766 |
| Molecular Formula | C21H41N4O3 |
| Molecular Weight | 397.58 g/mol |
| Exact Mass | 397.32 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NC(=O)CCNC2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C21H41N4O3/c1-18(2)11-15(12-19(3,4)24(18)27)22-10-9-17(26)23-16-13-20(5,6)25(28)21(7,8)14-16/h15-16,22,27H,9-14H2,1-8H3,(H,23,26) |
| InChIKey | LVPLIKWAIBUEJY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.58 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 59113766 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59113766?
The IUPAC name of CID 59113766 (CID 59113766) is not available.
What is the SMILES notation for CID 59113766?
The canonical SMILES for CID 59113766 is CC1(C)CC(NC(=O)CCNC2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1[O].
What is the InChIKey of CID 59113766?
The InChIKey is LVPLIKWAIBUEJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H41N4O3/c1-18(2)11-15(12-19(3,4)24(18)27)22-10-9-17(26)23-16-13-20(5,6)25(28)21(7,8)14-16/h15-16,22,27H,9-14H2,1-8H3,(H,23,26).
What are the key properties of CID 59113766?
CID 59113766 has a molecular weight of 397.58 g/mol, XLogP of 2.86, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59113766 is sourced from PubChem (CID 59113766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).