C22H22IN5O8 — CID 59114201
(5S,11S)-11-[(4-hydroxyphenyl)methyl]-18-iodo-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-5-carboxamide (PubChem CID 59114201) has the molecular formula C22H22IN5O8 and a molecular weight of 611.35 g/mol. Its IUPAC name is (5S,11S)-11-[(4-hydroxyphenyl)methyl]-18-iodo-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-5-carboxamide.
| Compound Name | (5S,11S)-11-[(4-hydroxyphenyl)methyl]-18-iodo-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-5-carboxamide |
|---|---|
| PubChem CID | 59114201 |
| Molecular Formula | C22H22IN5O8 |
| Molecular Weight | 611.35 g/mol |
| Exact Mass | 611.05 |
| IUPAC Name | (5S,11S)-11-[(4-hydroxyphenyl)methyl]-18-iodo-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-5-carboxamide |
| SMILES | NC(=O)[C@@H]1CCOc2c(I)cc([N+](=O)[O-])cc2C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)NCC(=O)N1 |
| InChI | InChI=1S/C22H22IN5O8/c23-15-9-12(28(34)35)8-14-19(15)36-6-5-16(20(24)31)26-18(30)10-25-22(33)17(27-21(14)32)7-11-1-3-13(29)4-2-11/h1-4,8-9,16-17,29H,5-7,10H2,(H2,24,31)(H,25,33)(H,26,30)(H,27,32)/t16-,17-/m0/s1 |
| InChIKey | RJZATCFHMQNDOK-IRXDYDNUSA-N |
| XLogP | 0.11 |
| TPSA | 202.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|