About (Z)-2-[2-[(4-methylcyclohexylidene)amino]phenyl]prop-1-en-1-ol;ytterbium
(Z)-2-[2-[(4-methylcyclohexylidene)amino]phenyl]prop-1-en-1-ol;ytterbium (PubChem CID 59114757) has the molecular formula C16H20NOYb-
and a molecular weight of 415.38 g/mol. Its IUPAC name is (Z)-2-[2-[(4-methylcyclohexylidene)amino]phenyl]prop-1-en-1-ol;ytterbium.
Molecular Properties
| Compound Name | (Z)-2-[2-[(4-methylcyclohexylidene)amino]phenyl]prop-1-en-1-ol;ytterbium |
| PubChem CID | 59114757 |
| Molecular Formula | C16H20NOYb- |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | (Z)-2-[2-[(4-methylcyclohexylidene)amino]phenyl]prop-1-en-1-ol;ytterbium |
| SMILES | C/C(=C/O)c1ccccc1N=C1CC[C-](C)CC1.[Yb] |
| InChI | InChI=1S/C16H20NO.Yb/c1-12-7-9-14(10-8-12)17-16-6-4-3-5-15(16)13(2)11-18;/h3-6,11,18H,7-10H2,1-2H3;/q-1;/b13-11-; |
| InChIKey | NYJHDRPAOULLSV-KEHAOADBSA-N |
| XLogP | 4.85 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-[2-[(4-methylcyclohexylidene)amino]phenyl]prop-1-en-1-ol;ytterbium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-[2-[(4-methylcyclohexylidene)amino]phenyl]prop-1-en-1-ol;ytterbium?
The IUPAC name of (Z)-2-[2-[(4-methylcyclohexylidene)amino]phenyl]prop-1-en-1-ol;ytterbium (CID 59114757) is (Z)-2-[2-[(4-methylcyclohexylidene)amino]phenyl]prop-1-en-1-ol;ytterbium.
What is the SMILES notation for (Z)-2-[2-[(4-methylcyclohexylidene)amino]phenyl]prop-1-en-1-ol;ytterbium?
The canonical SMILES for (Z)-2-[2-[(4-methylcyclohexylidene)amino]phenyl]prop-1-en-1-ol;ytterbium is C/C(=C/O)c1ccccc1N=C1CC[C-](C)CC1.[Yb].
What is the InChIKey of (Z)-2-[2-[(4-methylcyclohexylidene)amino]phenyl]prop-1-en-1-ol;ytterbium?
The InChIKey is NYJHDRPAOULLSV-KEHAOADBSA-N. The full InChI is InChI=1S/C16H20NO.Yb/c1-12-7-9-14(10-8-12)17-16-6-4-3-5-15(16)13(2)11-18;/h3-6,11,18H,7-10H2,1-2H3;/q-1;/b13-11-;.
What are the key properties of (Z)-2-[2-[(4-methylcyclohexylidene)amino]phenyl]prop-1-en-1-ol;ytterbium?
(Z)-2-[2-[(4-methylcyclohexylidene)amino]phenyl]prop-1-en-1-ol;ytterbium has a molecular weight of 415.38 g/mol, XLogP of 4.85, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-[2-[(4-methylcyclohexylidene)amino]phenyl]prop-1-en-1-ol;ytterbium is sourced from PubChem (CID 59114757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).