C25H13F5N2O6S3 — CID 59115146
[4-[[5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino]oxysulfonylphenyl] 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 59115146) has the molecular formula C25H13F5N2O6S3 and a molecular weight of 628.58 g/mol. Its IUPAC name is [4-[[5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino]oxysulfonylphenyl] 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | [4-[[5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino]oxysulfonylphenyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 59115146 |
| Molecular Formula | C25H13F5N2O6S3 |
| Molecular Weight | 628.58 g/mol |
| Exact Mass | 627.99 |
| IUPAC Name | [4-[[5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino]oxysulfonylphenyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | Cc1ccccc1C(C#N)=C1C=CC(=NOS(=O)(=O)c2ccc(OS(=O)(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)S1 |
| InChI | InChI=1S/C25H13F5N2O6S3/c1-13-4-2-3-5-16(13)17(12-31)18-10-11-19(39-18)32-38-40(33,34)15-8-6-14(7-9-15)37-41(35,36)25-23(29)21(27)20(26)22(28)24(25)30/h2-11H,1H3 |
| InChIKey | HWODPWBYRCRSGO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 122.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|