About cyclohexa-2,4-dien-1-ylmethyl N-butylcarbamate
cyclohexa-2,4-dien-1-ylmethyl N-butylcarbamate (PubChem CID 59115269) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is cyclohexa-2,4-dien-1-ylmethyl N-butylcarbamate.
Molecular Properties
| Compound Name | cyclohexa-2,4-dien-1-ylmethyl N-butylcarbamate |
| PubChem CID | 59115269 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | cyclohexa-2,4-dien-1-ylmethyl N-butylcarbamate |
| SMILES | CCCCNC(=O)OCC1C=CC=CC1 |
| InChI | InChI=1S/C12H19NO2/c1-2-3-9-13-12(14)15-10-11-7-5-4-6-8-11/h4-7,11H,2-3,8-10H2,1H3,(H,13,14) |
| InChIKey | ZJCYFYBZBJMTSR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-2,4-dien-1-ylmethyl N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,4-dien-1-ylmethyl N-butylcarbamate?
The IUPAC name of cyclohexa-2,4-dien-1-ylmethyl N-butylcarbamate (CID 59115269) is cyclohexa-2,4-dien-1-ylmethyl N-butylcarbamate.
What is the SMILES notation for cyclohexa-2,4-dien-1-ylmethyl N-butylcarbamate?
The canonical SMILES for cyclohexa-2,4-dien-1-ylmethyl N-butylcarbamate is CCCCNC(=O)OCC1C=CC=CC1.
What is the InChIKey of cyclohexa-2,4-dien-1-ylmethyl N-butylcarbamate?
The InChIKey is ZJCYFYBZBJMTSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-2-3-9-13-12(14)15-10-11-7-5-4-6-8-11/h4-7,11H,2-3,8-10H2,1H3,(H,13,14).
What are the key properties of cyclohexa-2,4-dien-1-ylmethyl N-butylcarbamate?
cyclohexa-2,4-dien-1-ylmethyl N-butylcarbamate has a molecular weight of 209.29 g/mol, XLogP of 2.64, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,4-dien-1-ylmethyl N-butylcarbamate is sourced from PubChem (CID 59115269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).