About (1S)-1-azido-1-(4,4-difluorocyclohexyl)propan-2-one
(1S)-1-azido-1-(4,4-difluorocyclohexyl)propan-2-one (PubChem CID 59115465) has the molecular formula C9H13F2N3O
and a molecular weight of 217.22 g/mol. Its IUPAC name is (1S)-1-azido-1-(4,4-difluorocyclohexyl)propan-2-one.
Molecular Properties
| Compound Name | (1S)-1-azido-1-(4,4-difluorocyclohexyl)propan-2-one |
| PubChem CID | 59115465 |
| Molecular Formula | C9H13F2N3O |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | (1S)-1-azido-1-(4,4-difluorocyclohexyl)propan-2-one |
| SMILES | CC(=O)[C@@H](N=[N+]=[N-])C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C9H13F2N3O/c1-6(15)8(13-14-12)7-2-4-9(10,11)5-3-7/h7-8H,2-5H2,1H3/t8-/m1/s1 |
| InChIKey | AUFBBKQWCNDLDN-MRVPVSSYSA-N |
| XLogP | 3.08 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-azido-1-(4,4-difluorocyclohexyl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-azido-1-(4,4-difluorocyclohexyl)propan-2-one?
The IUPAC name of (1S)-1-azido-1-(4,4-difluorocyclohexyl)propan-2-one (CID 59115465) is (1S)-1-azido-1-(4,4-difluorocyclohexyl)propan-2-one.
What is the SMILES notation for (1S)-1-azido-1-(4,4-difluorocyclohexyl)propan-2-one?
The canonical SMILES for (1S)-1-azido-1-(4,4-difluorocyclohexyl)propan-2-one is CC(=O)[C@@H](N=[N+]=[N-])C1CCC(F)(F)CC1.
What is the InChIKey of (1S)-1-azido-1-(4,4-difluorocyclohexyl)propan-2-one?
The InChIKey is AUFBBKQWCNDLDN-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H13F2N3O/c1-6(15)8(13-14-12)7-2-4-9(10,11)5-3-7/h7-8H,2-5H2,1H3/t8-/m1/s1.
What are the key properties of (1S)-1-azido-1-(4,4-difluorocyclohexyl)propan-2-one?
(1S)-1-azido-1-(4,4-difluorocyclohexyl)propan-2-one has a molecular weight of 217.22 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-azido-1-(4,4-difluorocyclohexyl)propan-2-one is sourced from PubChem (CID 59115465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).