C38H55N5O9 — CID 59115769
(2S)-2-[[2-[[3-[[2-[2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]-2-azaspiro[4.4]nonane-3-carbonyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetic acid (PubChem CID 59115769) has the molecular formula C38H55N5O9 and a molecular weight of 725.88 g/mol. Its IUPAC name is (2S)-2-[[2-[[3-[[2-[2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]-2-azaspiro[4.4]nonane-3-carbonyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[[2-[[3-[[2-[2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]-2-azaspiro[4.4]nonane-3-carbonyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 59115769 |
| Molecular Formula | C38H55N5O9 |
| Molecular Weight | 725.88 g/mol |
| Exact Mass | 725.40 |
| IUPAC Name | (2S)-2-[[2-[[3-[[2-[2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]-2-azaspiro[4.4]nonane-3-carbonyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetic acid |
| SMILES | CCCC(NC(=O)C1CC2(CCCC2)CN1C(=O)C(NC(=O)OCC(C)C)C1CCCCC1)C(=O)C(=O)NCC(=O)N[C@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C38H55N5O9/c1-4-13-27(32(45)34(47)39-21-29(44)41-31(36(49)50)26-16-9-6-10-17-26)40-33(46)28-20-38(18-11-12-19-38)23-43(28)35(48)30(25-14-7-5-8-15-25)42-37(51)52-22-24(2)3/h6,9-10,16-17,24-25,27-28,30-31H,4-5,7-8,11-15,18-23H2,1-3H3,(H,39,47)(H,40,46)(H,41,44)(H,42,51)(H,49,50)/t27?,28?,30?,31-/m0/s1 |
| InChIKey | BHCLXBQNYBBGBF-AMCRLTIXSA-N |
| XLogP | 3.39 |
| TPSA | 200.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.88 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|