C11H14F3NO — CID 59115925
N-[2,3,4,6-tetramethyl-5-(trifluoromethyl)phenyl]hydroxylamine (PubChem CID 59115925) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is N-[2,3,4,6-tetramethyl-5-(trifluoromethyl)phenyl]hydroxylamine.
| Compound Name | N-[2,3,4,6-tetramethyl-5-(trifluoromethyl)phenyl]hydroxylamine |
|---|---|
| PubChem CID | 59115925 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | N-[2,3,4,6-tetramethyl-5-(trifluoromethyl)phenyl]hydroxylamine |
| SMILES | Cc1c(C)c(NO)c(C)c(C(F)(F)F)c1C |
| InChI | InChI=1S/C11H14F3NO/c1-5-6(2)9(11(12,13)14)8(4)10(15-16)7(5)3/h15-16H,1-4H3 |
| InChIKey | KHXIMKLITSEZQL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|