C7H16N3O — CID 59116083
CID 59116083 (PubChem CID 59116083) has the molecular formula C7H16N3O and a molecular weight of 158.22 g/mol.
| Compound Name | CID 59116083 |
|---|---|
| PubChem CID | 59116083 |
| Molecular Formula | C7H16N3O |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | — |
| SMILES | CC(CCCN)NC(=O)C[NH] |
| InChI | InChI=1S/C7H16N3O/c1-6(3-2-4-8)10-7(11)5-9/h6,9H,2-5,8H2,1H3,(H,10,11) |
| InChIKey | MRRDQFGVUGJSHJ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |