C10H20N2 — CID 59116136
(2S)-1-N,1-N,2-N,2-N-tetramethylcyclohex-3-ene-1,2-diamine (PubChem CID 59116136) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (2S)-1-N,1-N,2-N,2-N-tetramethylcyclohex-3-ene-1,2-diamine.
| Compound Name | (2S)-1-N,1-N,2-N,2-N-tetramethylcyclohex-3-ene-1,2-diamine |
|---|---|
| PubChem CID | 59116136 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (2S)-1-N,1-N,2-N,2-N-tetramethylcyclohex-3-ene-1,2-diamine |
| SMILES | CN(C)C1CCC=C[C@@H]1N(C)C |
| InChI | InChI=1S/C10H20N2/c1-11(2)9-7-5-6-8-10(9)12(3)4/h5,7,9-10H,6,8H2,1-4H3/t9-,10?/m0/s1 |
| InChIKey | VBVRASAGYICUAT-RGURZIINSA-N |
| XLogP | 1.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|