About 2-(2-methoxyethoxy)ethyl 2,2-dimethyl-4-pyridin-4-ylhexanoate
2-(2-methoxyethoxy)ethyl 2,2-dimethyl-4-pyridin-4-ylhexanoate (PubChem CID 59116281) has the molecular formula C18H29NO4
and a molecular weight of 323.43 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl 2,2-dimethyl-4-pyridin-4-ylhexanoate.
Molecular Properties
| Compound Name | 2-(2-methoxyethoxy)ethyl 2,2-dimethyl-4-pyridin-4-ylhexanoate |
| PubChem CID | 59116281 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl 2,2-dimethyl-4-pyridin-4-ylhexanoate |
| SMILES | CCC(CC(C)(C)C(=O)OCCOCCOC)c1ccncc1 |
| InChI | InChI=1S/C18H29NO4/c1-5-15(16-6-8-19-9-7-16)14-18(2,3)17(20)23-13-12-22-11-10-21-4/h6-9,15H,5,10-14H2,1-4H3 |
| InChIKey | ALSLWEXYRYXIFZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxyethoxy)ethyl 2,2-dimethyl-4-pyridin-4-ylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethoxy)ethyl 2,2-dimethyl-4-pyridin-4-ylhexanoate?
The IUPAC name of 2-(2-methoxyethoxy)ethyl 2,2-dimethyl-4-pyridin-4-ylhexanoate (CID 59116281) is 2-(2-methoxyethoxy)ethyl 2,2-dimethyl-4-pyridin-4-ylhexanoate.
What is the SMILES notation for 2-(2-methoxyethoxy)ethyl 2,2-dimethyl-4-pyridin-4-ylhexanoate?
The canonical SMILES for 2-(2-methoxyethoxy)ethyl 2,2-dimethyl-4-pyridin-4-ylhexanoate is CCC(CC(C)(C)C(=O)OCCOCCOC)c1ccncc1.
What is the InChIKey of 2-(2-methoxyethoxy)ethyl 2,2-dimethyl-4-pyridin-4-ylhexanoate?
The InChIKey is ALSLWEXYRYXIFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO4/c1-5-15(16-6-8-19-9-7-16)14-18(2,3)17(20)23-13-12-22-11-10-21-4/h6-9,15H,5,10-14H2,1-4H3.
What are the key properties of 2-(2-methoxyethoxy)ethyl 2,2-dimethyl-4-pyridin-4-ylhexanoate?
2-(2-methoxyethoxy)ethyl 2,2-dimethyl-4-pyridin-4-ylhexanoate has a molecular weight of 323.43 g/mol, XLogP of 3.20, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethoxy)ethyl 2,2-dimethyl-4-pyridin-4-ylhexanoate is sourced from PubChem (CID 59116281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).