About (4R,5S)-4,5-dimethyl-3-(propylamino)oxolan-2-one
(4R,5S)-4,5-dimethyl-3-(propylamino)oxolan-2-one (PubChem CID 59116442) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is (4R,5S)-4,5-dimethyl-3-(propylamino)oxolan-2-one.
Molecular Properties
| Compound Name | (4R,5S)-4,5-dimethyl-3-(propylamino)oxolan-2-one |
| PubChem CID | 59116442 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (4R,5S)-4,5-dimethyl-3-(propylamino)oxolan-2-one |
| SMILES | CCCNC1C(=O)O[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C9H17NO2/c1-4-5-10-8-6(2)7(3)12-9(8)11/h6-8,10H,4-5H2,1-3H3/t6-,7-,8?/m0/s1 |
| InChIKey | HIJWAOFOYBBBHZ-WPZUCAASSA-N |
| XLogP | 0.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R,5S)-4,5-dimethyl-3-(propylamino)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5S)-4,5-dimethyl-3-(propylamino)oxolan-2-one?
The IUPAC name of (4R,5S)-4,5-dimethyl-3-(propylamino)oxolan-2-one (CID 59116442) is (4R,5S)-4,5-dimethyl-3-(propylamino)oxolan-2-one.
What is the SMILES notation for (4R,5S)-4,5-dimethyl-3-(propylamino)oxolan-2-one?
The canonical SMILES for (4R,5S)-4,5-dimethyl-3-(propylamino)oxolan-2-one is CCCNC1C(=O)O[C@@H](C)[C@@H]1C.
What is the InChIKey of (4R,5S)-4,5-dimethyl-3-(propylamino)oxolan-2-one?
The InChIKey is HIJWAOFOYBBBHZ-WPZUCAASSA-N. The full InChI is InChI=1S/C9H17NO2/c1-4-5-10-8-6(2)7(3)12-9(8)11/h6-8,10H,4-5H2,1-3H3/t6-,7-,8?/m0/s1.
What are the key properties of (4R,5S)-4,5-dimethyl-3-(propylamino)oxolan-2-one?
(4R,5S)-4,5-dimethyl-3-(propylamino)oxolan-2-one has a molecular weight of 171.24 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5S)-4,5-dimethyl-3-(propylamino)oxolan-2-one is sourced from PubChem (CID 59116442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).