C7H13NO2 — CID 59116447
(3S,4R,5S)-4,5-dimethyl-3-(methylamino)oxolan-2-one (PubChem CID 59116447) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is (3S,4R,5S)-4,5-dimethyl-3-(methylamino)oxolan-2-one.
| Compound Name | (3S,4R,5S)-4,5-dimethyl-3-(methylamino)oxolan-2-one |
|---|---|
| PubChem CID | 59116447 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (3S,4R,5S)-4,5-dimethyl-3-(methylamino)oxolan-2-one |
| SMILES | CN[C@@H]1C(=O)O[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C7H13NO2/c1-4-5(2)10-7(9)6(4)8-3/h4-6,8H,1-3H3/t4-,5-,6-/m0/s1 |
| InChIKey | DYGSCAXFMAGBSY-ZLUOBGJFSA-N |
| XLogP | 0.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |