About actinium;1-[(2S,4R)-4-hydroxy-1-methanidylpyrrolidin-2-yl]-2,2-dimethylpropan-1-one
actinium;1-[(2S,4R)-4-hydroxy-1-methanidylpyrrolidin-2-yl]-2,2-dimethylpropan-1-one (PubChem CID 59116554) has the molecular formula C10H18AcNO2-
and a molecular weight of 411.26 g/mol. Its IUPAC name is actinium;1-[(2S,4R)-4-hydroxy-1-methanidylpyrrolidin-2-yl]-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | actinium;1-[(2S,4R)-4-hydroxy-1-methanidylpyrrolidin-2-yl]-2,2-dimethylpropan-1-one |
| PubChem CID | 59116554 |
| Molecular Formula | C10H18AcNO2- |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | actinium;1-[(2S,4R)-4-hydroxy-1-methanidylpyrrolidin-2-yl]-2,2-dimethylpropan-1-one |
| SMILES | [Ac].[CH2-]N1C[C@H](O)C[C@H]1C(=O)C(C)(C)C |
| InChI | InChI=1S/C10H18NO2.Ac/c1-10(2,3)9(13)8-5-7(12)6-11(8)4;/h7-8,12H,4-6H2,1-3H3;/q-1;/t7-,8+;/m1./s1 |
| InChIKey | MZUCGNNOGDTZTG-WLYNEOFISA-N |
| XLogP | 0.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze actinium;1-[(2S,4R)-4-hydroxy-1-methanidylpyrrolidin-2-yl]-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;1-[(2S,4R)-4-hydroxy-1-methanidylpyrrolidin-2-yl]-2,2-dimethylpropan-1-one?
The IUPAC name of actinium;1-[(2S,4R)-4-hydroxy-1-methanidylpyrrolidin-2-yl]-2,2-dimethylpropan-1-one (CID 59116554) is actinium;1-[(2S,4R)-4-hydroxy-1-methanidylpyrrolidin-2-yl]-2,2-dimethylpropan-1-one.
What is the SMILES notation for actinium;1-[(2S,4R)-4-hydroxy-1-methanidylpyrrolidin-2-yl]-2,2-dimethylpropan-1-one?
The canonical SMILES for actinium;1-[(2S,4R)-4-hydroxy-1-methanidylpyrrolidin-2-yl]-2,2-dimethylpropan-1-one is [Ac].[CH2-]N1C[C@H](O)C[C@H]1C(=O)C(C)(C)C.
What is the InChIKey of actinium;1-[(2S,4R)-4-hydroxy-1-methanidylpyrrolidin-2-yl]-2,2-dimethylpropan-1-one?
The InChIKey is MZUCGNNOGDTZTG-WLYNEOFISA-N. The full InChI is InChI=1S/C10H18NO2.Ac/c1-10(2,3)9(13)8-5-7(12)6-11(8)4;/h7-8,12H,4-6H2,1-3H3;/q-1;/t7-,8+;/m1./s1.
What are the key properties of actinium;1-[(2S,4R)-4-hydroxy-1-methanidylpyrrolidin-2-yl]-2,2-dimethylpropan-1-one?
actinium;1-[(2S,4R)-4-hydroxy-1-methanidylpyrrolidin-2-yl]-2,2-dimethylpropan-1-one has a molecular weight of 411.26 g/mol, XLogP of 0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;1-[(2S,4R)-4-hydroxy-1-methanidylpyrrolidin-2-yl]-2,2-dimethylpropan-1-one is sourced from PubChem (CID 59116554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).