About actinium;1-methanidyloxy-3,3-dimethylbutan-2-one
actinium;1-methanidyloxy-3,3-dimethylbutan-2-one (PubChem CID 59116557) has the molecular formula C7H13AcO2-
and a molecular weight of 356.18 g/mol. Its IUPAC name is actinium;1-methanidyloxy-3,3-dimethylbutan-2-one.
Molecular Properties
| Compound Name | actinium;1-methanidyloxy-3,3-dimethylbutan-2-one |
| PubChem CID | 59116557 |
| Molecular Formula | C7H13AcO2- |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | actinium;1-methanidyloxy-3,3-dimethylbutan-2-one |
| SMILES | [Ac].[CH2-]OCC(=O)C(C)(C)C |
| InChI | InChI=1S/C7H13O2.Ac/c1-7(2,3)6(8)5-9-4;/h4-5H2,1-3H3;/q-1; |
| InChIKey | XUCZCHOVZQHGNH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze actinium;1-methanidyloxy-3,3-dimethylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;1-methanidyloxy-3,3-dimethylbutan-2-one?
The IUPAC name of actinium;1-methanidyloxy-3,3-dimethylbutan-2-one (CID 59116557) is actinium;1-methanidyloxy-3,3-dimethylbutan-2-one.
What is the SMILES notation for actinium;1-methanidyloxy-3,3-dimethylbutan-2-one?
The canonical SMILES for actinium;1-methanidyloxy-3,3-dimethylbutan-2-one is [Ac].[CH2-]OCC(=O)C(C)(C)C.
What is the InChIKey of actinium;1-methanidyloxy-3,3-dimethylbutan-2-one?
The InChIKey is XUCZCHOVZQHGNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13O2.Ac/c1-7(2,3)6(8)5-9-4;/h4-5H2,1-3H3;/q-1;.
What are the key properties of actinium;1-methanidyloxy-3,3-dimethylbutan-2-one?
actinium;1-methanidyloxy-3,3-dimethylbutan-2-one has a molecular weight of 356.18 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;1-methanidyloxy-3,3-dimethylbutan-2-one is sourced from PubChem (CID 59116557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).