C43H70BO11S — CID 59116801
CID 59116801 (PubChem CID 59116801) has the molecular formula C43H70BO11S and a molecular weight of 807.91 g/mol.
| Compound Name | CID 59116801 |
|---|---|
| PubChem CID | 59116801 |
| Molecular Formula | C43H70BO11S |
| Molecular Weight | 807.91 g/mol |
| Exact Mass | 807.48 |
| IUPAC Name | — |
| SMILES | [3H][B]SO[C@H](CC(=O)O[C@H](C[C@@H]1C/C(=C\C)C(OC(C)=O)[C@](O)(C(C)(C)/C=C/C=O)O1)C(C)C)C[C@@H]1CCC[C@H](C[C@@H]2CCO[C@@]3(C[C@H](C)CC[C@H]3C(C)C)O2)O1 |
| InChI | InChI=1S/C43H70BO11S/c1-10-31-21-35(54-43(48,40(31)50-30(7)46)41(8,9)18-12-19-45)24-38(28(4)5)52-39(47)25-36(55-56-44)23-33-14-11-13-32(51-33)22-34-17-20-49-42(53-34)26-29(6)15-16-37(42)27(2)3/h10,12,18-19,27-29,32-38,40,44,48H,11,13-17,20-26H2,1-9H3/b18-12+,31-10+/t29-,32-,33+,34+,35+,36+,37+,38-,40?,42+,43-/m1/s1/i44T |
| InChIKey | DUSXVMRIXKLPES-HARFUQGUSA-N |
| XLogP | 7.63 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.91 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|