C25H40O4 — CID 59116811
[(2S,3S,4E,6R)-4-ethylidene-2-methyl-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]-6-prop-2-enyloxan-3-yl] octanoate (PubChem CID 59116811) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is [(2S,3S,4E,6R)-4-ethylidene-2-methyl-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]-6-prop-2-enyloxan-3-yl] octanoate.
| Compound Name | [(2S,3S,4E,6R)-4-ethylidene-2-methyl-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]-6-prop-2-enyloxan-3-yl] octanoate |
|---|---|
| PubChem CID | 59116811 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | [(2S,3S,4E,6R)-4-ethylidene-2-methyl-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]-6-prop-2-enyloxan-3-yl] octanoate |
| SMILES | C=CC[C@@H]1C/C(=C\C)[C@H](OC(=O)CCCCCCC)[C@](C)(C(C)(C)/C=C/C=O)O1 |
| InChI | InChI=1S/C25H40O4/c1-7-10-11-12-13-16-22(27)28-23-20(9-3)19-21(15-8-2)29-25(23,6)24(4,5)17-14-18-26/h8-9,14,17-18,21,23H,2,7,10-13,15-16,19H2,1,3-6H3/b17-14+,20-9+/t21-,23+,25-/m1/s1 |
| InChIKey | ZYUVUNVGJMOBEM-MSWTXSFWSA-N |
| XLogP | 6.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|