About 1-[4-[(3-oxo-1,2-benzoselenazol-2-yl)methyl]phenyl]-N-propan-2-ylmethanimine oxide
1-[4-[(3-oxo-1,2-benzoselenazol-2-yl)methyl]phenyl]-N-propan-2-ylmethanimine oxide (PubChem CID 59116839) has the molecular formula C18H18N2O2Se
and a molecular weight of 373.31 g/mol. Its IUPAC name is 1-[4-[(3-oxo-1,2-benzoselenazol-2-yl)methyl]phenyl]-N-propan-2-ylmethanimine oxide.
Molecular Properties
| Compound Name | 1-[4-[(3-oxo-1,2-benzoselenazol-2-yl)methyl]phenyl]-N-propan-2-ylmethanimine oxide |
| PubChem CID | 59116839 |
| Molecular Formula | C18H18N2O2Se |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 1-[4-[(3-oxo-1,2-benzoselenazol-2-yl)methyl]phenyl]-N-propan-2-ylmethanimine oxide |
| SMILES | CC(C)/[N+]([O-])=C\c1ccc(Cn2[se]c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C18H18N2O2Se/c1-13(2)19(22)11-14-7-9-15(10-8-14)12-20-18(21)16-5-3-4-6-17(16)23-20/h3-11,13H,12H2,1-2H3/b19-11+ |
| InChIKey | JNSUCKXMTDPBTJ-YBFXNURJSA-N |
| XLogP | 2.44 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(3-oxo-1,2-benzoselenazol-2-yl)methyl]phenyl]-N-propan-2-ylmethanimine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(3-oxo-1,2-benzoselenazol-2-yl)methyl]phenyl]-N-propan-2-ylmethanimine oxide?
The IUPAC name of 1-[4-[(3-oxo-1,2-benzoselenazol-2-yl)methyl]phenyl]-N-propan-2-ylmethanimine oxide (CID 59116839) is 1-[4-[(3-oxo-1,2-benzoselenazol-2-yl)methyl]phenyl]-N-propan-2-ylmethanimine oxide.
What is the SMILES notation for 1-[4-[(3-oxo-1,2-benzoselenazol-2-yl)methyl]phenyl]-N-propan-2-ylmethanimine oxide?
The canonical SMILES for 1-[4-[(3-oxo-1,2-benzoselenazol-2-yl)methyl]phenyl]-N-propan-2-ylmethanimine oxide is CC(C)/[N+]([O-])=C\c1ccc(Cn2[se]c3ccccc3c2=O)cc1.
What is the InChIKey of 1-[4-[(3-oxo-1,2-benzoselenazol-2-yl)methyl]phenyl]-N-propan-2-ylmethanimine oxide?
The InChIKey is JNSUCKXMTDPBTJ-YBFXNURJSA-N. The full InChI is InChI=1S/C18H18N2O2Se/c1-13(2)19(22)11-14-7-9-15(10-8-14)12-20-18(21)16-5-3-4-6-17(16)23-20/h3-11,13H,12H2,1-2H3/b19-11+.
What are the key properties of 1-[4-[(3-oxo-1,2-benzoselenazol-2-yl)methyl]phenyl]-N-propan-2-ylmethanimine oxide?
1-[4-[(3-oxo-1,2-benzoselenazol-2-yl)methyl]phenyl]-N-propan-2-ylmethanimine oxide has a molecular weight of 373.31 g/mol, XLogP of 2.44, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(3-oxo-1,2-benzoselenazol-2-yl)methyl]phenyl]-N-propan-2-ylmethanimine oxide is sourced from PubChem (CID 59116839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).