C11H16N2O — CID 59117160
3-(piperidin-1-ylmethyl)-1H-pyridin-2-one (PubChem CID 59117160) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-(piperidin-1-ylmethyl)-1H-pyridin-2-one.
| Compound Name | 3-(piperidin-1-ylmethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 59117160 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 3-(piperidin-1-ylmethyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cccc1CN1CCCCC1 |
| InChI | InChI=1S/C11H16N2O/c14-11-10(5-4-6-12-11)9-13-7-2-1-3-8-13/h4-6H,1-3,7-9H2,(H,12,14) |
| InChIKey | HUHFZHHXVBAQTK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |