C16H25O2SiY- — CID 59118258
tert-butyl-dimethyl-(2,3,4,6-tetrahydrochromen-6-id-2-ylmethoxy)silane;yttrium (PubChem CID 59118258) has the molecular formula C16H25O2SiY- and a molecular weight of 366.37 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2,3,4,6-tetrahydrochromen-6-id-2-ylmethoxy)silane;yttrium.
| Compound Name | tert-butyl-dimethyl-(2,3,4,6-tetrahydrochromen-6-id-2-ylmethoxy)silane;yttrium |
|---|---|
| PubChem CID | 59118258 |
| Molecular Formula | C16H25O2SiY- |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | tert-butyl-dimethyl-(2,3,4,6-tetrahydrochromen-6-id-2-ylmethoxy)silane;yttrium |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CCc2c[c-]ccc2O1.[Y] |
| InChI | InChI=1S/C16H25O2Si.Y/c1-16(2,3)19(4,5)17-12-14-11-10-13-8-6-7-9-15(13)18-14;/h7-9,14H,10-12H2,1-5H3;/q-1; |
| InChIKey | XJRXGPNIQHCEDK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|