About trimethyl-(2-piperidin-1-yl-1,3-thiazol-4-yl)stannane
trimethyl-(2-piperidin-1-yl-1,3-thiazol-4-yl)stannane (PubChem CID 59118286) has the molecular formula C11H20N2SSn
and a molecular weight of 331.07 g/mol. Its IUPAC name is trimethyl-(2-piperidin-1-yl-1,3-thiazol-4-yl)stannane.
Molecular Properties
| Compound Name | trimethyl-(2-piperidin-1-yl-1,3-thiazol-4-yl)stannane |
| PubChem CID | 59118286 |
| Molecular Formula | C11H20N2SSn |
| Molecular Weight | 331.07 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | trimethyl-(2-piperidin-1-yl-1,3-thiazol-4-yl)stannane |
| SMILES | C[Sn](C)(C)c1csc(N2CCCCC2)n1 |
| InChI | InChI=1S/C8H11N2S.3CH3.Sn/c1-2-5-10(6-3-1)8-9-4-7-11-8;;;;/h7H,1-3,5-6H2;3*1H3; |
| InChIKey | WADWAKRUZRHOLM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.07 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trimethyl-(2-piperidin-1-yl-1,3-thiazol-4-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-(2-piperidin-1-yl-1,3-thiazol-4-yl)stannane?
The IUPAC name of trimethyl-(2-piperidin-1-yl-1,3-thiazol-4-yl)stannane (CID 59118286) is trimethyl-(2-piperidin-1-yl-1,3-thiazol-4-yl)stannane.
What is the SMILES notation for trimethyl-(2-piperidin-1-yl-1,3-thiazol-4-yl)stannane?
The canonical SMILES for trimethyl-(2-piperidin-1-yl-1,3-thiazol-4-yl)stannane is C[Sn](C)(C)c1csc(N2CCCCC2)n1.
What is the InChIKey of trimethyl-(2-piperidin-1-yl-1,3-thiazol-4-yl)stannane?
The InChIKey is WADWAKRUZRHOLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N2S.3CH3.Sn/c1-2-5-10(6-3-1)8-9-4-7-11-8;;;;/h7H,1-3,5-6H2;3*1H3;.
What are the key properties of trimethyl-(2-piperidin-1-yl-1,3-thiazol-4-yl)stannane?
trimethyl-(2-piperidin-1-yl-1,3-thiazol-4-yl)stannane has a molecular weight of 331.07 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-(2-piperidin-1-yl-1,3-thiazol-4-yl)stannane is sourced from PubChem (CID 59118286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).