C46H46N3O3+3 — CID 59118361
4-[(6R)-4,5-bis(4-formylphenyl)-2,3,6-tris(1-methylpyridin-1-ium-4-yl)heptyl]benzaldehyde (PubChem CID 59118361) has the molecular formula C46H46N3O3+3 and a molecular weight of 688.89 g/mol. Its IUPAC name is 4-[(6R)-4,5-bis(4-formylphenyl)-2,3,6-tris(1-methylpyridin-1-ium-4-yl)heptyl]benzaldehyde.
| Compound Name | 4-[(6R)-4,5-bis(4-formylphenyl)-2,3,6-tris(1-methylpyridin-1-ium-4-yl)heptyl]benzaldehyde |
|---|---|
| PubChem CID | 59118361 |
| Molecular Formula | C46H46N3O3+3 |
| Molecular Weight | 688.89 g/mol |
| Exact Mass | 688.35 |
| IUPAC Name | 4-[(6R)-4,5-bis(4-formylphenyl)-2,3,6-tris(1-methylpyridin-1-ium-4-yl)heptyl]benzaldehyde |
| SMILES | C[C@@H](c1cc[n+](C)cc1)C(c1ccc(C=O)cc1)C(c1ccc(C=O)cc1)C(c1cc[n+](C)cc1)C(Cc1ccc(C=O)cc1)c1cc[n+](C)cc1 |
| InChI | InChI=1S/C46H46N3O3/c1-33(38-17-23-47(2)24-18-38)44(40-13-9-36(31-51)10-14-40)46(41-15-11-37(32-52)12-16-41)45(42-21-27-49(4)28-22-42)43(39-19-25-48(3)26-20-39)29-34-5-7-35(30-50)8-6-34/h5-28,30-33,43-46H,29H2,1-4H3/q+3/t33-,43?,44?,45?,46?/m0/s1 |
| InChIKey | SVXXLLFIPOYMNR-LSHSOKRYSA-N |
| XLogP | 7.08 |
| TPSA | 62.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.89 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|