About (3S)-7,7-dimethyl-3-(methylideneamino)azepan-2-one
(3S)-7,7-dimethyl-3-(methylideneamino)azepan-2-one (PubChem CID 59118695) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is (3S)-7,7-dimethyl-3-(methylideneamino)azepan-2-one.
Molecular Properties
| Compound Name | (3S)-7,7-dimethyl-3-(methylideneamino)azepan-2-one |
| PubChem CID | 59118695 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (3S)-7,7-dimethyl-3-(methylideneamino)azepan-2-one |
| SMILES | C=N[C@H]1CCCC(C)(C)NC1=O |
| InChI | InChI=1S/C9H16N2O/c1-9(2)6-4-5-7(10-3)8(12)11-9/h7H,3-6H2,1-2H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | FZFJQBKCZXRMDC-ZETCQYMHSA-N |
| XLogP | 1.13 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3S)-7,7-dimethyl-3-(methylideneamino)azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-7,7-dimethyl-3-(methylideneamino)azepan-2-one?
The IUPAC name of (3S)-7,7-dimethyl-3-(methylideneamino)azepan-2-one (CID 59118695) is (3S)-7,7-dimethyl-3-(methylideneamino)azepan-2-one.
What is the SMILES notation for (3S)-7,7-dimethyl-3-(methylideneamino)azepan-2-one?
The canonical SMILES for (3S)-7,7-dimethyl-3-(methylideneamino)azepan-2-one is C=N[C@H]1CCCC(C)(C)NC1=O.
What is the InChIKey of (3S)-7,7-dimethyl-3-(methylideneamino)azepan-2-one?
The InChIKey is FZFJQBKCZXRMDC-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H16N2O/c1-9(2)6-4-5-7(10-3)8(12)11-9/h7H,3-6H2,1-2H3,(H,11,12)/t7-/m0/s1.
What are the key properties of (3S)-7,7-dimethyl-3-(methylideneamino)azepan-2-one?
(3S)-7,7-dimethyl-3-(methylideneamino)azepan-2-one has a molecular weight of 168.24 g/mol, XLogP of 1.13, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-7,7-dimethyl-3-(methylideneamino)azepan-2-one is sourced from PubChem (CID 59118695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).