About 2-methanidylprop-1-ene;2-(2-methylprop-2-enoxymethoxy)oxane;yttrium
2-methanidylprop-1-ene;2-(2-methylprop-2-enoxymethoxy)oxane;yttrium (PubChem CID 59118732) has the molecular formula C14H24O3Y-2
and a molecular weight of 329.25 g/mol. Its IUPAC name is 2-methanidylprop-1-ene;2-(2-methylprop-2-enoxymethoxy)oxane;yttrium.
Molecular Properties
| Compound Name | 2-methanidylprop-1-ene;2-(2-methylprop-2-enoxymethoxy)oxane;yttrium |
| PubChem CID | 59118732 |
| Molecular Formula | C14H24O3Y-2 |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 2-methanidylprop-1-ene;2-(2-methylprop-2-enoxymethoxy)oxane;yttrium |
| SMILES | C=C([CH2-])C.[H]/[C-]=C(/C)COCOC1CCCCO1.[Y] |
| InChI | InChI=1S/C10H17O3.C4H7.Y/c1-9(2)7-11-8-13-10-5-3-4-6-12-10;1-4(2)3;/h1,10H,3-8H2,2H3;1-2H2,3H3;/q2*-1; |
| InChIKey | MTROKOPYPXUJHY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-methanidylprop-1-ene;2-(2-methylprop-2-enoxymethoxy)oxane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanidylprop-1-ene;2-(2-methylprop-2-enoxymethoxy)oxane;yttrium?
The IUPAC name of 2-methanidylprop-1-ene;2-(2-methylprop-2-enoxymethoxy)oxane;yttrium (CID 59118732) is 2-methanidylprop-1-ene;2-(2-methylprop-2-enoxymethoxy)oxane;yttrium.
What is the SMILES notation for 2-methanidylprop-1-ene;2-(2-methylprop-2-enoxymethoxy)oxane;yttrium?
The canonical SMILES for 2-methanidylprop-1-ene;2-(2-methylprop-2-enoxymethoxy)oxane;yttrium is C=C([CH2-])C.[H]/[C-]=C(/C)COCOC1CCCCO1.[Y].
What is the InChIKey of 2-methanidylprop-1-ene;2-(2-methylprop-2-enoxymethoxy)oxane;yttrium?
The InChIKey is MTROKOPYPXUJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17O3.C4H7.Y/c1-9(2)7-11-8-13-10-5-3-4-6-12-10;1-4(2)3;/h1,10H,3-8H2,2H3;1-2H2,3H3;/q2*-1;.
What are the key properties of 2-methanidylprop-1-ene;2-(2-methylprop-2-enoxymethoxy)oxane;yttrium?
2-methanidylprop-1-ene;2-(2-methylprop-2-enoxymethoxy)oxane;yttrium has a molecular weight of 329.25 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanidylprop-1-ene;2-(2-methylprop-2-enoxymethoxy)oxane;yttrium is sourced from PubChem (CID 59118732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).