C26H25F2N — CID 59118818
(1R,4S)-N-benzhydryl-4-(3,5-difluorophenyl)-4-methylcyclohex-2-en-1-amine (PubChem CID 59118818) has the molecular formula C26H25F2N and a molecular weight of 389.49 g/mol. Its IUPAC name is (1R,4S)-N-benzhydryl-4-(3,5-difluorophenyl)-4-methylcyclohex-2-en-1-amine.
| Compound Name | (1R,4S)-N-benzhydryl-4-(3,5-difluorophenyl)-4-methylcyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 59118818 |
| Molecular Formula | C26H25F2N |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (1R,4S)-N-benzhydryl-4-(3,5-difluorophenyl)-4-methylcyclohex-2-en-1-amine |
| SMILES | C[C@@]1(c2cc(F)cc(F)c2)C=C[C@H](NC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H25F2N/c1-26(21-16-22(27)18-23(28)17-21)14-12-24(13-15-26)29-25(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-12,14,16-18,24-25,29H,13,15H2,1H3/t24-,26+/m0/s1 |
| InChIKey | FHBUYGGKLWXNMQ-AZGAKELHSA-N |
| XLogP | 6.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|