C22H29ClO6 — CID 59118973
[2-[(8S,9S,11S,13S,14S,17R)-11,17-dihydroxy-13-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-chloroacetate (PubChem CID 59118973) has the molecular formula C22H29ClO6 and a molecular weight of 424.92 g/mol. Its IUPAC name is [2-[(8S,9S,11S,13S,14S,17R)-11,17-dihydroxy-13-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-chloroacetate.
| Compound Name | [2-[(8S,9S,11S,13S,14S,17R)-11,17-dihydroxy-13-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-chloroacetate |
|---|---|
| PubChem CID | 59118973 |
| Molecular Formula | C22H29ClO6 |
| Molecular Weight | 424.92 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [2-[(8S,9S,11S,13S,14S,17R)-11,17-dihydroxy-13-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-chloroacetate |
| SMILES | C[C@]12C[C@H](O)[C@@H]3C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@]2(O)C(=O)COC(=O)CCl |
| InChI | InChI=1S/C22H29ClO6/c1-21-9-17(25)20-14-5-3-13(24)8-12(14)2-4-15(20)16(21)6-7-22(21,28)18(26)11-29-19(27)10-23/h8,14-17,20,25,28H,2-7,9-11H2,1H3/t14?,15-,16-,17-,20+,21-,22-/m0/s1 |
| InChIKey | DSTOKPSCUFAYFI-UKCKIUPSSA-N |
| XLogP | 2.18 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.92 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|