C12H28N4O — CID 59119182
3,6-bis(3-aminopropylamino)hexan-2-one (PubChem CID 59119182) has the molecular formula C12H28N4O and a molecular weight of 244.38 g/mol. Its IUPAC name is 3,6-bis(3-aminopropylamino)hexan-2-one.
| Compound Name | 3,6-bis(3-aminopropylamino)hexan-2-one |
|---|---|
| PubChem CID | 59119182 |
| Molecular Formula | C12H28N4O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.23 |
| IUPAC Name | 3,6-bis(3-aminopropylamino)hexan-2-one |
| SMILES | CC(=O)C(CCCNCCCN)NCCCN |
| InChI | InChI=1S/C12H28N4O/c1-11(17)12(16-10-4-7-14)5-2-8-15-9-3-6-13/h12,15-16H,2-10,13-14H2,1H3 |
| InChIKey | CWXDHUYHKOAIIY-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|