C17H30N4 — CID 59119738
3,6,9-triethyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-triene (PubChem CID 59119738) has the molecular formula C17H30N4 and a molecular weight of 290.45 g/mol. Its IUPAC name is 3,6,9-triethyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-triene.
| Compound Name | 3,6,9-triethyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-triene |
|---|---|
| PubChem CID | 59119738 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 3,6,9-triethyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-triene |
| SMILES | CCN1CCN(CC)Cc2cccc(n2)CN(CC)CC1 |
| InChI | InChI=1S/C17H30N4/c1-4-19-10-12-20(5-2)14-16-8-7-9-17(18-16)15-21(6-3)13-11-19/h7-9H,4-6,10-15H2,1-3H3 |
| InChIKey | IXPFJJMCIZDAHD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |