About CID 59119827
CID 59119827 (PubChem CID 59119827) has the molecular formula C9H18BO3P
and a molecular weight of 217.03 g/mol.
Molecular Properties
| Compound Name | CID 59119827 |
| PubChem CID | 59119827 |
| Molecular Formula | C9H18BO3P |
| Molecular Weight | 217.03 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | — |
| SMILES | [2H]P(=C)(OC)OC1C(CC)OC([B])C1C |
| InChI | InChI=1S/C9H18BO3P/c1-5-7-8(13-14(4)11-3)6(2)9(10)12-7/h6-9,14H,4-5H2,1-3H3/i14D |
| InChIKey | IBRCIBRDNJBNBW-FCFVPJCTSA-N |
| XLogP | 1.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.03 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 59119827 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59119827?
The IUPAC name of CID 59119827 (CID 59119827) is not available.
What is the SMILES notation for CID 59119827?
The canonical SMILES for CID 59119827 is [2H]P(=C)(OC)OC1C(CC)OC([B])C1C.
What is the InChIKey of CID 59119827?
The InChIKey is IBRCIBRDNJBNBW-FCFVPJCTSA-N. The full InChI is InChI=1S/C9H18BO3P/c1-5-7-8(13-14(4)11-3)6(2)9(10)12-7/h6-9,14H,4-5H2,1-3H3/i14D.
What are the key properties of CID 59119827?
CID 59119827 has a molecular weight of 217.03 g/mol, XLogP of 1.43, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59119827 is sourced from PubChem (CID 59119827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).