methyl 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate

C12H13NO2S2 — CID 591202

IUPACmethyl 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate
SMILESCOC(=O)c1ccc(CSC2=NCCS2)cc1
InChIInChI=1S/C12H13NO2S2/c1-15-11(14)10-4-2-9(3-5-10)8-17-12-13-6-7-16-12/h2-5H,6-8H2,1H3
InChIKeyLGQKIMQROHFJGL-UHFFFAOYSA-N
MW267.38 g/mol
LogP2.81
Rot. Bonds3

About methyl 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate

methyl 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate (PubChem CID 591202) has the molecular formula C12H13NO2S2 and a molecular weight of 267.38 g/mol. Its IUPAC name is methyl 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate.

Molecular Properties

Compound Namemethyl 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate
PubChem CID591202
Molecular FormulaC12H13NO2S2
Molecular Weight267.38 g/mol
Exact Mass267.04
IUPAC Namemethyl 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate
SMILESCOC(=O)c1ccc(CSC2=NCCS2)cc1
InChIInChI=1S/C12H13NO2S2/c1-15-11(14)10-4-2-9(3-5-10)8-17-12-13-6-7-16-12/h2-5H,6-8H2,1H3
InChIKeyLGQKIMQROHFJGL-UHFFFAOYSA-N
XLogP2.81
TPSA38.66 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.38
LogP ≤ 52.81
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate?
The IUPAC name of methyl 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate (CID 591202) is methyl 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate.
What is the SMILES notation for methyl 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate?
The canonical SMILES for methyl 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate is COC(=O)c1ccc(CSC2=NCCS2)cc1.
What is the InChIKey of methyl 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate?
The InChIKey is LGQKIMQROHFJGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2S2/c1-15-11(14)10-4-2-9(3-5-10)8-17-12-13-6-7-16-12/h2-5H,6-8H2,1H3.
What are the key properties of methyl 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate?
methyl 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate has a molecular weight of 267.38 g/mol, XLogP of 2.81, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate is sourced from PubChem (CID 591202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).