C21H26BFN3O5 — CID 59120379
CID 59120379 (PubChem CID 59120379) has the molecular formula C21H26BFN3O5 and a molecular weight of 430.27 g/mol.
| Compound Name | CID 59120379 |
|---|---|
| PubChem CID | 59120379 |
| Molecular Formula | C21H26BFN3O5 |
| Molecular Weight | 430.27 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | — |
| SMILES | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](Cc1ccc(F)cc1)N[B]C=O |
| InChI | InChI=1S/C21H26BFN3O5/c1-2-31-19(28)8-7-17(12-15-9-10-24-20(15)29)25-21(30)18(26-22-13-27)11-14-3-5-16(23)6-4-14/h3-8,13,15,17-18,26H,2,9-12H2,1H3,(H,24,29)(H,25,30)/b8-7+/t15-,17+,18-/m0/s1 |
| InChIKey | OUDNGANTTZEUCD-ONMALZNDSA-N |
| XLogP | 0.27 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|