About (2Z)-2-(1,2-dihydropyridin-2-ylmethylidene)-1H-pyridine
(2Z)-2-(1,2-dihydropyridin-2-ylmethylidene)-1H-pyridine (PubChem CID 59121117) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is (2Z)-2-(1,2-dihydropyridin-2-ylmethylidene)-1H-pyridine.
Molecular Properties
| Compound Name | (2Z)-2-(1,2-dihydropyridin-2-ylmethylidene)-1H-pyridine |
| PubChem CID | 59121117 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | (2Z)-2-(1,2-dihydropyridin-2-ylmethylidene)-1H-pyridine |
| SMILES | C1=CN/C(=C\C2C=CC=CN2)C=C1 |
| InChI | InChI=1S/C11H12N2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13-11/h1-10,12-13H/b11-9- |
| InChIKey | RQFDHLKLRLVKJG-LUAWRHEFSA-N |
| XLogP | 1.59 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2Z)-2-(1,2-dihydropyridin-2-ylmethylidene)-1H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(1,2-dihydropyridin-2-ylmethylidene)-1H-pyridine?
The IUPAC name of (2Z)-2-(1,2-dihydropyridin-2-ylmethylidene)-1H-pyridine (CID 59121117) is (2Z)-2-(1,2-dihydropyridin-2-ylmethylidene)-1H-pyridine.
What is the SMILES notation for (2Z)-2-(1,2-dihydropyridin-2-ylmethylidene)-1H-pyridine?
The canonical SMILES for (2Z)-2-(1,2-dihydropyridin-2-ylmethylidene)-1H-pyridine is C1=CN/C(=C\C2C=CC=CN2)C=C1.
What is the InChIKey of (2Z)-2-(1,2-dihydropyridin-2-ylmethylidene)-1H-pyridine?
The InChIKey is RQFDHLKLRLVKJG-LUAWRHEFSA-N. The full InChI is InChI=1S/C11H12N2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13-11/h1-10,12-13H/b11-9-.
What are the key properties of (2Z)-2-(1,2-dihydropyridin-2-ylmethylidene)-1H-pyridine?
(2Z)-2-(1,2-dihydropyridin-2-ylmethylidene)-1H-pyridine has a molecular weight of 172.23 g/mol, XLogP of 1.59, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(1,2-dihydropyridin-2-ylmethylidene)-1H-pyridine is sourced from PubChem (CID 59121117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).