C29H32Cl2N6O — CID 59121208
3-[(2E)-2-[cyano(isocyano)methylidene]-3-[(3,5-dichlorophenyl)methyl]imidazolidin-1-yl]-N-[2-methyl-3-(piperidin-1-ylmethyl)phenyl]propanamide (PubChem CID 59121208) has the molecular formula C29H32Cl2N6O and a molecular weight of 551.52 g/mol. Its IUPAC name is 3-[(2E)-2-[cyano(isocyano)methylidene]-3-[(3,5-dichlorophenyl)methyl]imidazolidin-1-yl]-N-[2-methyl-3-(piperidin-1-ylmethyl)phenyl]propanamide.
| Compound Name | 3-[(2E)-2-[cyano(isocyano)methylidene]-3-[(3,5-dichlorophenyl)methyl]imidazolidin-1-yl]-N-[2-methyl-3-(piperidin-1-ylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 59121208 |
| Molecular Formula | C29H32Cl2N6O |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | 3-[(2E)-2-[cyano(isocyano)methylidene]-3-[(3,5-dichlorophenyl)methyl]imidazolidin-1-yl]-N-[2-methyl-3-(piperidin-1-ylmethyl)phenyl]propanamide |
| SMILES | [C-]#[N+]/C(C#N)=C1\N(CCC(=O)Nc2cccc(CN3CCCCC3)c2C)CCN1Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C29H32Cl2N6O/c1-21-23(20-35-10-4-3-5-11-35)7-6-8-26(21)34-28(38)9-12-36-13-14-37(29(36)27(18-32)33-2)19-22-15-24(30)17-25(31)16-22/h6-8,15-17H,3-5,9-14,19-20H2,1H3,(H,34,38)/b29-27+ |
| InChIKey | KRUQTRRGEMHLDQ-ORIPQNMZSA-N |
| XLogP | 6.05 |
| TPSA | 66.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|