C19H14FNO3S — CID 59122013
1-[5-[(4-fluorophenyl)methoxy]thiophen-2-yl]-3-pyridin-2-ylpropane-1,3-dione (PubChem CID 59122013) has the molecular formula C19H14FNO3S and a molecular weight of 355.39 g/mol. Its IUPAC name is 1-[5-[(4-fluorophenyl)methoxy]thiophen-2-yl]-3-pyridin-2-ylpropane-1,3-dione.
| Compound Name | 1-[5-[(4-fluorophenyl)methoxy]thiophen-2-yl]-3-pyridin-2-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 59122013 |
| Molecular Formula | C19H14FNO3S |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 1-[5-[(4-fluorophenyl)methoxy]thiophen-2-yl]-3-pyridin-2-ylpropane-1,3-dione |
| SMILES | O=C(CC(=O)c1ccc(OCc2ccc(F)cc2)s1)c1ccccn1 |
| InChI | InChI=1S/C19H14FNO3S/c20-14-6-4-13(5-7-14)12-24-19-9-8-18(25-19)17(23)11-16(22)15-3-1-2-10-21-15/h1-10H,11-12H2 |
| InChIKey | UFCJRJYXXYMLCU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|