About 3-iminobutanimidamide
3-iminobutanimidamide (PubChem CID 59122062) has the molecular formula C4H9N3
and a molecular weight of 99.14 g/mol. Its IUPAC name is 3-iminobutanimidamide.
Molecular Properties
| Compound Name | 3-iminobutanimidamide |
| PubChem CID | 59122062 |
| Molecular Formula | C4H9N3 |
| Molecular Weight | 99.14 g/mol |
| Exact Mass | 99.08 |
| IUPAC Name | 3-iminobutanimidamide |
| SMILES | [H]/N=C(\N)C/C(C)=N/[H] |
| InChI | InChI=1S/C4H9N3/c1-3(5)2-4(6)7/h5H,2H2,1H3,(H3,6,7)/b5-3+ |
| InChIKey | KXMCMQRZQPXUQC-HWKANZROSA-N |
| XLogP | 0.35 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.14 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-iminobutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iminobutanimidamide?
The IUPAC name of 3-iminobutanimidamide (CID 59122062) is 3-iminobutanimidamide.
What is the SMILES notation for 3-iminobutanimidamide?
The canonical SMILES for 3-iminobutanimidamide is [H]/N=C(\N)C/C(C)=N/[H].
What is the InChIKey of 3-iminobutanimidamide?
The InChIKey is KXMCMQRZQPXUQC-HWKANZROSA-N. The full InChI is InChI=1S/C4H9N3/c1-3(5)2-4(6)7/h5H,2H2,1H3,(H3,6,7)/b5-3+.
What are the key properties of 3-iminobutanimidamide?
3-iminobutanimidamide has a molecular weight of 99.14 g/mol, XLogP of 0.35, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iminobutanimidamide is sourced from PubChem (CID 59122062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).